C23H18N6O3 — CID 11524705
N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]benzamide (PubChem CID 11524705) has the molecular formula C23H18N6O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]benzamide.
| Compound Name | N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]benzamide |
|---|---|
| PubChem CID | 11524705 |
| Molecular Formula | C23H18N6O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]benzamide |
| SMILES | COc1ccc(-n2nc3c(NC(=O)c4ccccc4)nc4c(N)cccc4n3c2=O)cc1 |
| InChI | InChI=1S/C23H18N6O3/c1-32-16-12-10-15(11-13-16)29-23(31)28-18-9-5-8-17(24)19(18)25-20(21(28)27-29)26-22(30)14-6-3-2-4-7-14/h2-13H,24H2,1H3,(H,25,26,30) |
| InChIKey | JCJKDJKCTJXHPY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|