C13H13N3O3 — CID 115247785
3-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]oxetane-3-carbonitrile (PubChem CID 115247785) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 3-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]oxetane-3-carbonitrile.
| Compound Name | 3-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 115247785 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]oxetane-3-carbonitrile |
| SMILES | N#CC1(CN2C(=O)COc3ccc(N)cc32)COC1 |
| InChI | InChI=1S/C13H13N3O3/c14-5-13(7-18-8-13)6-16-10-3-9(15)1-2-11(10)19-4-12(16)17/h1-3H,4,6-8,15H2 |
| InChIKey | DNPPUKILXSLZII-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|