C14H20N2O3 — CID 115250676
6-[2-(hydroxymethyl)butyl-methylamino]-4H-1,4-benzoxazin-3-one (PubChem CID 115250676) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)butyl-methylamino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(hydroxymethyl)butyl-methylamino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115250676 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 6-[2-(hydroxymethyl)butyl-methylamino]-4H-1,4-benzoxazin-3-one |
| SMILES | CCC(CO)CN(C)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H20N2O3/c1-3-10(8-17)7-16(2)11-4-5-13-12(6-11)15-14(18)9-19-13/h4-6,10,17H,3,7-9H2,1-2H3,(H,15,18) |
| InChIKey | RIDNDYZYZMNDJT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|