C14H25N3 — CID 115252913
N-methyl-2-propan-2-yl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine (PubChem CID 115252913) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-methyl-2-propan-2-yl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine.
| Compound Name | N-methyl-2-propan-2-yl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115252913 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-methyl-2-propan-2-yl-N'-(2-pyridin-3-ylethyl)propane-1,3-diamine |
| SMILES | CNCC(CNCCc1cccnc1)C(C)C |
| InChI | InChI=1S/C14H25N3/c1-12(2)14(10-15-3)11-17-8-6-13-5-4-7-16-9-13/h4-5,7,9,12,14-15,17H,6,8,10-11H2,1-3H3 |
| InChIKey | HYQHBJFXLHSJCG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|