C10H14F2N2 — CID 115407048
N-(2,2-difluoroethyl)-3-pyridin-3-ylpropan-1-amine (PubChem CID 115407048) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-pyridin-3-ylpropan-1-amine.
| Compound Name | N-(2,2-difluoroethyl)-3-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 115407048 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-pyridin-3-ylpropan-1-amine |
| SMILES | FC(F)CNCCCc1cccnc1 |
| InChI | InChI=1S/C10H14F2N2/c11-10(12)8-14-6-2-4-9-3-1-5-13-7-9/h1,3,5,7,10,14H,2,4,6,8H2 |
| InChIKey | KSUNDCUWFBBGKP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|