C11H18FN3O — CID 115261118
2-(4-ethoxy-3-fluorophenyl)-N-(hydrazinylmethyl)ethanamine (PubChem CID 115261118) has the molecular formula C11H18FN3O and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-(4-ethoxy-3-fluorophenyl)-N-(hydrazinylmethyl)ethanamine.
| Compound Name | 2-(4-ethoxy-3-fluorophenyl)-N-(hydrazinylmethyl)ethanamine |
|---|---|
| PubChem CID | 115261118 |
| Molecular Formula | C11H18FN3O |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-(4-ethoxy-3-fluorophenyl)-N-(hydrazinylmethyl)ethanamine |
| SMILES | CCOc1ccc(CCNCNN)cc1F |
| InChI | InChI=1S/C11H18FN3O/c1-2-16-11-4-3-9(7-10(11)12)5-6-14-8-15-13/h3-4,7,14-15H,2,5-6,8,13H2,1H3 |
| InChIKey | RXBWDPWSUDCNJO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|