C14H20FNO3 — CID 115163095
N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-4-hydroxybutanamide (PubChem CID 115163095) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-4-hydroxybutanamide.
| Compound Name | N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 115163095 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-4-hydroxybutanamide |
| SMILES | CCOc1ccc(CCNC(=O)CCCO)cc1F |
| InChI | InChI=1S/C14H20FNO3/c1-2-19-13-6-5-11(10-12(13)15)7-8-16-14(18)4-3-9-17/h5-6,10,17H,2-4,7-9H2,1H3,(H,16,18) |
| InChIKey | GVJUAQOPNLXCIA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |