C12H16FNO2S — CID 115167384
N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-2-sulfanylacetamide (PubChem CID 115167384) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167384 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | N-[2-(4-ethoxy-3-fluorophenyl)ethyl]-2-sulfanylacetamide |
| SMILES | CCOc1ccc(CCNC(=O)CS)cc1F |
| InChI | InChI=1S/C12H16FNO2S/c1-2-16-11-4-3-9(7-10(11)13)5-6-14-12(15)8-17/h3-4,7,17H,2,5-6,8H2,1H3,(H,14,15) |
| InChIKey | VBHPGALASQHTBR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|