C9H13N3O2S — CID 115268228
N-(5-amino-2-pyridinyl)-N-cyclopropylmethanesulfonamide (PubChem CID 115268228) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-N-cyclopropylmethanesulfonamide.
| Compound Name | N-(5-amino-2-pyridinyl)-N-cyclopropylmethanesulfonamide |
|---|---|
| PubChem CID | 115268228 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-N-cyclopropylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(c1ccc(N)cn1)C1CC1 |
| InChI | InChI=1S/C9H13N3O2S/c1-15(13,14)12(8-3-4-8)9-5-2-7(10)6-11-9/h2,5-6,8H,3-4,10H2,1H3 |
| InChIKey | PWKPJPURJITKNA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |