C30H35NO11S — CID 11527372
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate (PubChem CID 11527372) has the molecular formula C30H35NO11S and a molecular weight of 617.67 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11527372 |
| Molecular Formula | C30H35NO11S |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.19 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](SC2C=CC3C4Cc5ccc(O)c6c5C3(CCN4C)C2O6)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H35NO11S/c1-13(32)38-23-24(39-14(2)33)26(40-15(3)34)29(42-25(23)28(36)37-5)43-20-9-7-17-18-12-16-6-8-19(35)22-21(16)30(17,27(20)41-22)10-11-31(18)4/h6-9,17-18,20,23-27,29,35H,10-12H2,1-5H3/t17?,18?,20?,23-,24-,25-,26+,27?,29-,30?/m0/s1 |
| InChIKey | AODYBGGPJRWXMB-QOQCTBEMSA-N |
| XLogP | 1.63 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|