C33H39NO12S — CID 11636087
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 11636087) has the molecular formula C33H39NO12S and a molecular weight of 673.74 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11636087 |
| Molecular Formula | C33H39NO12S |
| Molecular Weight | 673.74 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SC2C=CC3C4Cc5ccc(OC(C)=O)c6c5C3(CCN4C)C2O6)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H39NO12S/c1-15(35)40-14-24-28(42-17(3)37)29(43-18(4)38)30(44-19(5)39)32(45-24)47-25-10-8-21-22-13-20-7-9-23(41-16(2)36)27-26(20)33(21,31(25)46-27)11-12-34(22)6/h7-10,21-22,24-25,28-32H,11-14H2,1-6H3/t21?,22?,24-,25?,28-,29+,30-,31?,32+,33?/m1/s1 |
| InChIKey | XXIWLAROSAAJRD-REUJAUPTSA-N |
| XLogP | 2.24 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|