C22H27NO6 — CID 20638316
[(4R,4aR,7S,7aR,12bS)-7-[(2R)-2,3-dihydroxypropoxy]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate (PubChem CID 20638316) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-7-[(2R)-2,3-dihydroxypropoxy]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-7-[(2R)-2,3-dihydroxypropoxy]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
|---|---|
| PubChem CID | 20638316 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-7-[(2R)-2,3-dihydroxypropoxy]-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](OC[C@H](O)CO)C=C[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C22H27NO6/c1-12(25)28-17-5-3-13-9-16-15-4-6-18(27-11-14(26)10-24)21-22(15,7-8-23(16)2)19(13)20(17)29-21/h3-6,14-16,18,21,24,26H,7-11H2,1-2H3/t14-,15+,16-,18+,21+,22+/m1/s1 |
| InChIKey | GAHLMQFFEUIHIA-OSWJDQBTSA-N |
| XLogP | 0.80 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|