C32H37NO12S — CID 59415703
methyl (2S,3R,4S,5R)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate (PubChem CID 59415703) has the molecular formula C32H37NO12S and a molecular weight of 659.71 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 59415703 |
| Molecular Formula | C32H37NO12S |
| Molecular Weight | 659.71 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | methyl (2S,3R,4S,5R)-3,4,5-triacetyloxy-6-[(9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl)sulfanyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(SC2C=CC3C4Cc5ccc(OC(C)=O)c6c5C3(CCN4C)C2O6)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H37NO12S/c1-14(34)40-21-9-7-18-13-20-19-8-10-22(29-32(19,11-12-33(20)5)23(18)24(21)44-29)46-31-28(43-17(4)37)26(42-16(3)36)25(41-15(2)35)27(45-31)30(38)39-6/h7-10,19-20,22,25-29,31H,11-13H2,1-6H3/t19?,20?,22?,25-,26+,27+,28-,29?,31?,32?/m1/s1 |
| InChIKey | FDACUKQNARRBTL-IBJOWLGBSA-N |
| XLogP | 1.85 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|