C14H11Cl2N3 — CID 115281793
2-(3,4-dichlorophenyl)-5,7-dimethylimidazo[1,2-a]pyrimidine (PubChem CID 115281793) has the molecular formula C14H11Cl2N3 and a molecular weight of 292.17 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-5,7-dimethylimidazo[1,2-a]pyrimidine.
| Compound Name | 2-(3,4-dichlorophenyl)-5,7-dimethylimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 115281793 |
| Molecular Formula | C14H11Cl2N3 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-5,7-dimethylimidazo[1,2-a]pyrimidine |
| SMILES | Cc1cc(C)n2cc(-c3ccc(Cl)c(Cl)c3)nc2n1 |
| InChI | InChI=1S/C14H11Cl2N3/c1-8-5-9(2)19-7-13(18-14(19)17-8)10-3-4-11(15)12(16)6-10/h3-7H,1-2H3 |
| InChIKey | ZHFKEPOQEKWFKW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |