C9H11N3S — CID 87896349
(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methanethiol (PubChem CID 87896349) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methanethiol.
| Compound Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methanethiol |
|---|---|
| PubChem CID | 87896349 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methanethiol |
| SMILES | Cc1cc(C)n2cc(CS)nc2n1 |
| InChI | InChI=1S/C9H11N3S/c1-6-3-7(2)12-4-8(5-13)11-9(12)10-6/h3-4,13H,5H2,1-2H3 |
| InChIKey | BJTVLEZLUJKENK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|