C14H18N4S2 — CID 47109704
(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl pyrrolidine-1-carbodithioate (PubChem CID 47109704) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl pyrrolidine-1-carbodithioate.
| Compound Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 47109704 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl pyrrolidine-1-carbodithioate |
| SMILES | Cc1cc(C)n2cc(CSC(=S)N3CCCC3)nc2n1 |
| InChI | InChI=1S/C14H18N4S2/c1-10-7-11(2)18-8-12(16-13(18)15-10)9-20-14(19)17-5-3-4-6-17/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | UYIVMFNQBWFEGB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|