C13H16N4OS3 — CID 7614166
(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl pyrrolidine-1-carbodithioate (PubChem CID 7614166) has the molecular formula C13H16N4OS3 and a molecular weight of 340.50 g/mol. Its IUPAC name is (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl pyrrolidine-1-carbodithioate.
| Compound Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7614166 |
| Molecular Formula | C13H16N4OS3 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl pyrrolidine-1-carbodithioate |
| SMILES | CCc1nn2c(=O)cc(CSC(=S)N3CCCC3)nc2s1 |
| InChI | InChI=1S/C13H16N4OS3/c1-2-10-15-17-11(18)7-9(14-12(17)21-10)8-20-13(19)16-5-3-4-6-16/h7H,2-6,8H2,1H3 |
| InChIKey | RFPWUEPWEZFIOR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|