C14H16N5+ — CID 21239033
1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyridin-1-ium-2-amine (PubChem CID 21239033) has the molecular formula C14H16N5+ and a molecular weight of 254.32 g/mol. Its IUPAC name is 1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyridin-1-ium-2-amine.
| Compound Name | 1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 21239033 |
| Molecular Formula | C14H16N5+ |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]pyridin-1-ium-2-amine |
| SMILES | Cc1cc(C)n2cc(C[n+]3ccccc3N)nc2n1 |
| InChI | InChI=1S/C14H15N5/c1-10-7-11(2)19-9-12(17-14(19)16-10)8-18-6-4-3-5-13(18)15/h3-7,9,15H,8H2,1-2H3/p+1 |
| InChIKey | YIGSGLXAEUAJMF-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|