C20H24N4 — CID 41105580
(1R)-N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 41105580) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is (1R)-N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 41105580 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1R)-N-[(5,7-dimethylimidazo[1,2-a]pyrimidin-2-yl)methyl]-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Cc1cc(C)n2cc(CN(C)[C@@H]3CCCc4ccccc43)nc2n1 |
| InChI | InChI=1S/C20H24N4/c1-14-11-15(2)24-13-17(22-20(24)21-14)12-23(3)19-10-6-8-16-7-4-5-9-18(16)19/h4-5,7,9,11,13,19H,6,8,10,12H2,1-3H3/t19-/m1/s1 |
| InChIKey | GQUVGQLONIBHFN-LJQANCHMSA-N |
| XLogP | 3.86 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |