About 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol
8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 177392581) has the molecular formula C19H13Cl2N3O
and a molecular weight of 370.24 g/mol. Its IUPAC name is 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol.
Molecular Properties
| Compound Name | 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol |
| PubChem CID | 177392581 |
| Molecular Formula | C19H13Cl2N3O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Cc1nc2c(-c3ccc(Cl)c(Cl)c3)nc(-c3ccccc3)cn2c1O |
| InChI | InChI=1S/C19H13Cl2N3O/c1-11-19(25)24-10-16(12-5-3-2-4-6-12)23-17(18(24)22-11)13-7-8-14(20)15(21)9-13/h2-10,25H,1H3 |
| InChIKey | LPFJOMXJMVMHHE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol?
The IUPAC name of 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol (CID 177392581) is 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol.
What is the SMILES notation for 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol?
The canonical SMILES for 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol is Cc1nc2c(-c3ccc(Cl)c(Cl)c3)nc(-c3ccccc3)cn2c1O.
What is the InChIKey of 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol?
The InChIKey is LPFJOMXJMVMHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2N3O/c1-11-19(25)24-10-16(12-5-3-2-4-6-12)23-17(18(24)22-11)13-7-8-14(20)15(21)9-13/h2-10,25H,1H3.
What are the key properties of 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol?
8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol has a molecular weight of 370.24 g/mol, XLogP of 5.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,4-dichlorophenyl)-2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol is sourced from PubChem (CID 177392581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).