C22H16N4O2 — CID 137285364
2-(furan-2-ylmethyl)-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 137285364) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 2-(furan-2-ylmethyl)-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 2-(furan-2-ylmethyl)-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137285364 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(furan-2-ylmethyl)-6-phenyl-8-pyridin-4-ylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccco2)nc2c(-c3ccncc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C22H16N4O2/c27-22-18(13-17-7-4-12-28-17)25-21-20(16-8-10-23-11-9-16)24-19(14-26(21)22)15-5-2-1-3-6-15/h1-12,14,27H,13H2 |
| InChIKey | CZNIXWRKXFTVNS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |