C22H15ClN4O2 — CID 137285354
8-(2-chloro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 137285354) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is 8-(2-chloro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-(2-chloro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137285354 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 8-(2-chloro-4-pyridinyl)-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccco2)nc2c(-c3ccnc(Cl)c3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C22H15ClN4O2/c23-19-11-15(8-9-24-19)20-21-26-17(12-16-7-4-10-29-16)22(28)27(21)13-18(25-20)14-5-2-1-3-6-14/h1-11,13,28H,12H2 |
| InChIKey | JHKNLDRWQCLXTA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|