C21H14ClFN6O2 — CID 176803916
6-(3-amino-2-fluorophenyl)-8-(6-chloropyridazin-4-yl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 176803916) has the molecular formula C21H14ClFN6O2 and a molecular weight of 436.83 g/mol. Its IUPAC name is 6-(3-amino-2-fluorophenyl)-8-(6-chloropyridazin-4-yl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(3-amino-2-fluorophenyl)-8-(6-chloropyridazin-4-yl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 176803916 |
| Molecular Formula | C21H14ClFN6O2 |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 6-(3-amino-2-fluorophenyl)-8-(6-chloropyridazin-4-yl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Nc1cccc(-c2cn3c(O)c(Cc4ccco4)nc3c(-c3cnnc(Cl)c3)n2)c1F |
| InChI | InChI=1S/C21H14ClFN6O2/c22-17-7-11(9-25-28-17)19-20-27-15(8-12-3-2-6-31-12)21(30)29(20)10-16(26-19)13-4-1-5-14(24)18(13)23/h1-7,9-10,30H,8,24H2 |
| InChIKey | CLERHDRAVJTNDX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|