C23H17N3OS — CID 136717674
2-benzyl-6-phenyl-8-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 136717674) has the molecular formula C23H17N3OS and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-benzyl-6-phenyl-8-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 2-benzyl-6-phenyl-8-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 136717674 |
| Molecular Formula | C23H17N3OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-benzyl-6-phenyl-8-thiophen-2-ylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccccc2)nc2c(-c3cccs3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C23H17N3OS/c27-23-18(14-16-8-3-1-4-9-16)25-22-21(20-12-7-13-28-20)24-19(15-26(22)23)17-10-5-2-6-11-17/h1-13,15,27H,14H2 |
| InChIKey | KPESSBRQNNLXOP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |