C26H22N4O2 — CID 163908697
6-(4-aminophenyl)-8-benzyl-2-[(4-hydroxyphenyl)methyl]imidazo[1,2-a]pyrazin-3-ol (PubChem CID 163908697) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 6-(4-aminophenyl)-8-benzyl-2-[(4-hydroxyphenyl)methyl]imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(4-aminophenyl)-8-benzyl-2-[(4-hydroxyphenyl)methyl]imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 163908697 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 6-(4-aminophenyl)-8-benzyl-2-[(4-hydroxyphenyl)methyl]imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Nc1ccc(-c2cn3c(O)c(Cc4ccc(O)cc4)nc3c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H22N4O2/c27-20-10-8-19(9-11-20)24-16-30-25(22(28-24)14-17-4-2-1-3-5-17)29-23(26(30)32)15-18-6-12-21(31)13-7-18/h1-13,16,31-32H,14-15,27H2 |
| InChIKey | IXXISUNBFSBYGD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|