C29H21N3O4 — CID 146226121
6-[[8-benzyl-3-hydroxy-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]chromen-2-one (PubChem CID 146226121) has the molecular formula C29H21N3O4 and a molecular weight of 475.50 g/mol. Its IUPAC name is 6-[[8-benzyl-3-hydroxy-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]chromen-2-one.
| Compound Name | 6-[[8-benzyl-3-hydroxy-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 146226121 |
| Molecular Formula | C29H21N3O4 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 6-[[8-benzyl-3-hydroxy-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]chromen-2-one |
| SMILES | O=c1ccc2cc(Cc3nc4c(Cc5ccccc5)nc(-c5ccc(O)cc5)cn4c3O)ccc2o1 |
| InChI | InChI=1S/C29H21N3O4/c33-22-10-7-20(8-11-22)25-17-32-28(23(30-25)15-18-4-2-1-3-5-18)31-24(29(32)35)16-19-6-12-26-21(14-19)9-13-27(34)36-26/h1-14,17,33,35H,15-16H2 |
| InChIKey | GKEZZARLQRMVDX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|