C22H17N5OS — CID 137230845
8-benzyl-6-phenyl-2-(thiadiazol-5-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 137230845) has the molecular formula C22H17N5OS and a molecular weight of 399.48 g/mol. Its IUPAC name is 8-benzyl-6-phenyl-2-(thiadiazol-5-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-benzyl-6-phenyl-2-(thiadiazol-5-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137230845 |
| Molecular Formula | C22H17N5OS |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 8-benzyl-6-phenyl-2-(thiadiazol-5-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2cnns2)nc2c(Cc3ccccc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C22H17N5OS/c28-22-19(12-17-13-23-26-29-17)25-21-18(11-15-7-3-1-4-8-15)24-20(14-27(21)22)16-9-5-2-6-10-16/h1-10,13-14,28H,11-12H2 |
| InChIKey | NHZYZFKRFAAOJS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |