C27H19N3O3 — CID 135980278
6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-phenylethynyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 135980278) has the molecular formula C27H19N3O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-phenylethynyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-phenylethynyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 135980278 |
| Molecular Formula | C27H19N3O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(2-phenylethynyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1ccc(Cc2nc3c(C#Cc4ccccc4)nc(-c4ccc(O)cc4)cn3c2O)cc1 |
| InChI | InChI=1S/C27H19N3O3/c31-21-11-6-19(7-12-21)16-24-27(33)30-17-25(20-9-13-22(32)14-10-20)28-23(26(30)29-24)15-8-18-4-2-1-3-5-18/h1-7,9-14,17,31-33H,16H2 |
| InChIKey | ZJYXEONJCHNUAX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|