C25H18N4O5 — CID 135980260
6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 135980260) has the molecular formula C25H18N4O5 and a molecular weight of 454.44 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 135980260 |
| Molecular Formula | C25H18N4O5 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 6-(4-hydroxyphenyl)-2-[(4-hydroxyphenyl)methyl]-8-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccc(O)cc3)cn3c(O)c(Cc4ccc(O)cc4)nc23)cc1 |
| InChI | InChI=1S/C25H18N4O5/c30-19-9-1-15(2-10-19)13-21-25(32)28-14-22(16-5-11-20(31)12-6-16)26-23(24(28)27-21)17-3-7-18(8-4-17)29(33)34/h1-12,14,30-32H,13H2 |
| InChIKey | CAYUHNYWJLRTHV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|