C32H40N6O2 — CID 136870464
8-hexyl-6-[4-(8-hexyl-3-hydroxy-2-methylimidazo[1,2-a]pyrazin-6-yl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-ol (PubChem CID 136870464) has the molecular formula C32H40N6O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is 8-hexyl-6-[4-(8-hexyl-3-hydroxy-2-methylimidazo[1,2-a]pyrazin-6-yl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 8-hexyl-6-[4-(8-hexyl-3-hydroxy-2-methylimidazo[1,2-a]pyrazin-6-yl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 136870464 |
| Molecular Formula | C32H40N6O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 8-hexyl-6-[4-(8-hexyl-3-hydroxy-2-methylimidazo[1,2-a]pyrazin-6-yl)phenyl]-2-methylimidazo[1,2-a]pyrazin-3-ol |
| SMILES | CCCCCCc1nc(-c2ccc(-c3cn4c(O)c(C)nc4c(CCCCCC)n3)cc2)cn2c(O)c(C)nc12 |
| InChI | InChI=1S/C32H40N6O2/c1-5-7-9-11-13-25-29-33-21(3)31(39)37(29)19-27(35-25)23-15-17-24(18-16-23)28-20-38-30(34-22(4)32(38)40)26(36-28)14-12-10-8-6-2/h15-20,39-40H,5-14H2,1-4H3 |
| InChIKey | RHMIYCFAWDGFLK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|