C17H21N3S — CID 19209447
2-hexyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 19209447) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-hexyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-hexyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 19209447 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-hexyl-6-(4-methylphenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCCCCCc1nn2cc(-c3ccc(C)cc3)nc2s1 |
| InChI | InChI=1S/C17H21N3S/c1-3-4-5-6-7-16-19-20-12-15(18-17(20)21-16)14-10-8-13(2)9-11-14/h8-12H,3-7H2,1-2H3 |
| InChIKey | IPHLANPXKYOIKD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|