C15H17N3OS — CID 9122841
2-butyl-6-(3-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 9122841) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-butyl-6-(3-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-butyl-6-(3-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 9122841 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-butyl-6-(3-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | CCCCc1nn2cc(-c3cccc(OC)c3)nc2s1 |
| InChI | InChI=1S/C15H17N3OS/c1-3-4-8-14-17-18-10-13(16-15(18)20-14)11-6-5-7-12(9-11)19-2/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | SXJQILZXTLUGGZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |