C12H9F2N3S — CID 115284668
(4,6-difluoro-1H-benzimidazol-2-yl)-thiophen-2-ylmethanamine (PubChem CID 115284668) has the molecular formula C12H9F2N3S and a molecular weight of 265.29 g/mol. Its IUPAC name is (4,6-difluoro-1H-benzimidazol-2-yl)-thiophen-2-ylmethanamine.
| Compound Name | (4,6-difluoro-1H-benzimidazol-2-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 115284668 |
| Molecular Formula | C12H9F2N3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (4,6-difluoro-1H-benzimidazol-2-yl)-thiophen-2-ylmethanamine |
| SMILES | NC(c1nc2c(F)cc(F)cc2[nH]1)c1cccs1 |
| InChI | InChI=1S/C12H9F2N3S/c13-6-4-7(14)11-8(5-6)16-12(17-11)10(15)9-2-1-3-18-9/h1-5,10H,15H2,(H,16,17) |
| InChIKey | XVELRVSSQFFSQD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |