C10H10N6S — CID 114607939
8-[amino(thiophen-2-yl)methyl]-7H-purin-6-amine (PubChem CID 114607939) has the molecular formula C10H10N6S and a molecular weight of 246.30 g/mol. Its IUPAC name is 8-[amino(thiophen-2-yl)methyl]-7H-purin-6-amine.
| Compound Name | 8-[amino(thiophen-2-yl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 114607939 |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 8-[amino(thiophen-2-yl)methyl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(C(N)c3cccs3)[nH]c12 |
| InChI | InChI=1S/C10H10N6S/c11-6(5-2-1-3-17-5)9-15-7-8(12)13-4-14-10(7)16-9/h1-4,6H,11H2,(H3,12,13,14,15,16) |
| InChIKey | DHCLAXADCZLEEZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |