C10H8BrN5OS — CID 136658013
2-amino-8-[bromo(thiophen-2-yl)methyl]-1,7-dihydropurin-6-one (PubChem CID 136658013) has the molecular formula C10H8BrN5OS and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-amino-8-[bromo(thiophen-2-yl)methyl]-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-[bromo(thiophen-2-yl)methyl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136658013 |
| Molecular Formula | C10H8BrN5OS |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 2-amino-8-[bromo(thiophen-2-yl)methyl]-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(C(Br)c3cccs3)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H8BrN5OS/c11-5(4-2-1-3-18-4)7-13-6-8(14-7)15-10(12)16-9(6)17/h1-3,5H,(H4,12,13,14,15,16,17) |
| InChIKey | BMCLDDFKBIHPCN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|