C10H13N5O3S — CID 136745618
2-amino-8-(1,1-dioxothian-2-yl)-1,7-dihydropurin-6-one (PubChem CID 136745618) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-amino-8-(1,1-dioxothian-2-yl)-1,7-dihydropurin-6-one.
| Compound Name | 2-amino-8-(1,1-dioxothian-2-yl)-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 136745618 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-amino-8-(1,1-dioxothian-2-yl)-1,7-dihydropurin-6-one |
| SMILES | Nc1nc2nc(C3CCCCS3(=O)=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N5O3S/c11-10-14-8-6(9(16)15-10)12-7(13-8)5-3-1-2-4-19(5,17)18/h5H,1-4H2,(H4,11,12,13,14,15,16) |
| InChIKey | LJZQIQPICZYEKA-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 134.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |