C11H17N3O3S — CID 115078016
2-(3-pyrrolidin-3-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide (PubChem CID 115078016) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-(3-pyrrolidin-3-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide.
| Compound Name | 2-(3-pyrrolidin-3-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115078016 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(3-pyrrolidin-3-yl-1,2,4-oxadiazol-5-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1c1nc(C2CCNC2)no1 |
| InChI | InChI=1S/C11H17N3O3S/c15-18(16)6-2-1-3-9(18)11-13-10(14-17-11)8-4-5-12-7-8/h8-9,12H,1-7H2 |
| InChIKey | SZIZPFPNLUTSIQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |