C8H12N6O — CID 106108785
8-(2-amino-1-methoxyethyl)-7H-purin-6-amine (PubChem CID 106108785) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is 8-(2-amino-1-methoxyethyl)-7H-purin-6-amine.
| Compound Name | 8-(2-amino-1-methoxyethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 106108785 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 8-(2-amino-1-methoxyethyl)-7H-purin-6-amine |
| SMILES | COC(CN)c1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C8H12N6O/c1-15-4(2-9)7-13-5-6(10)11-3-12-8(5)14-7/h3-4H,2,9H2,1H3,(H3,10,11,12,13,14) |
| InChIKey | ALDLZJOPEVAQMT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |