About (6-amino-7H-purin-8-yl) acetate
(6-amino-7H-purin-8-yl) acetate (PubChem CID 130015261) has the molecular formula C7H7N5O2
and a molecular weight of 193.17 g/mol. Its IUPAC name is (6-amino-7H-purin-8-yl) acetate.
Molecular Properties
| Compound Name | (6-amino-7H-purin-8-yl) acetate |
| PubChem CID | 130015261 |
| Molecular Formula | C7H7N5O2 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (6-amino-7H-purin-8-yl) acetate |
| SMILES | CC(=O)Oc1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C7H7N5O2/c1-3(13)14-7-11-4-5(8)9-2-10-6(4)12-7/h2H,1H3,(H3,8,9,10,11,12) |
| InChIKey | BLOZSOYCWRRFRO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-amino-7H-purin-8-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-7H-purin-8-yl) acetate?
The IUPAC name of (6-amino-7H-purin-8-yl) acetate (CID 130015261) is (6-amino-7H-purin-8-yl) acetate.
What is the SMILES notation for (6-amino-7H-purin-8-yl) acetate?
The canonical SMILES for (6-amino-7H-purin-8-yl) acetate is CC(=O)Oc1nc2ncnc(N)c2[nH]1.
What is the InChIKey of (6-amino-7H-purin-8-yl) acetate?
The InChIKey is BLOZSOYCWRRFRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O2/c1-3(13)14-7-11-4-5(8)9-2-10-6(4)12-7/h2H,1H3,(H3,8,9,10,11,12).
What are the key properties of (6-amino-7H-purin-8-yl) acetate?
(6-amino-7H-purin-8-yl) acetate has a molecular weight of 193.17 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-7H-purin-8-yl) acetate is sourced from PubChem (CID 130015261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).