C11H15N3OS — CID 115285006
(3-butyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine (PubChem CID 115285006) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is (3-butyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine.
| Compound Name | (3-butyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 115285006 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (3-butyl-1,2,4-oxadiazol-5-yl)-thiophen-2-ylmethanamine |
| SMILES | CCCCc1noc(C(N)c2cccs2)n1 |
| InChI | InChI=1S/C11H15N3OS/c1-2-3-6-9-13-11(15-14-9)10(12)8-5-4-7-16-8/h4-5,7,10H,2-3,6,12H2,1H3 |
| InChIKey | FTPYBEYNQWVWGV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |