C12H19NO2S — CID 115285085
3,3-dimethylbutyl 2-amino-2-thiophen-2-ylacetate (PubChem CID 115285085) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3,3-dimethylbutyl 2-amino-2-thiophen-2-ylacetate.
| Compound Name | 3,3-dimethylbutyl 2-amino-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 115285085 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3,3-dimethylbutyl 2-amino-2-thiophen-2-ylacetate |
| SMILES | CC(C)(C)CCOC(=O)C(N)c1cccs1 |
| InChI | InChI=1S/C12H19NO2S/c1-12(2,3)6-7-15-11(14)10(13)9-5-4-8-16-9/h4-5,8,10H,6-7,13H2,1-3H3 |
| InChIKey | PDENHGAQVWIIPF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |