C15H22N2O3S — CID 115285564
2-[(2,4-dimethylcyclohexyl)carbamoylamino]-2-thiophen-2-ylacetic acid (PubChem CID 115285564) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[(2,4-dimethylcyclohexyl)carbamoylamino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(2,4-dimethylcyclohexyl)carbamoylamino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115285564 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[(2,4-dimethylcyclohexyl)carbamoylamino]-2-thiophen-2-ylacetic acid |
| SMILES | CC1CCC(NC(=O)NC(C(=O)O)c2cccs2)C(C)C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-9-5-6-11(10(2)8-9)16-15(20)17-13(14(18)19)12-4-3-7-21-12/h3-4,7,9-11,13H,5-6,8H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | DVBNLATXJICFAJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |