C12H13N3O5S — CID 115285619
2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-2-thiophen-2-ylacetic acid (PubChem CID 115285619) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115285619 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoylamino]-2-thiophen-2-ylacetic acid |
| SMILES | CN1C(=O)CC(NC(=O)NC(C(=O)O)c2cccs2)C1=O |
| InChI | InChI=1S/C12H13N3O5S/c1-15-8(16)5-6(10(15)17)13-12(20)14-9(11(18)19)7-3-2-4-21-7/h2-4,6,9H,5H2,1H3,(H,18,19)(H2,13,14,20) |
| InChIKey | OHIJIBSJQKXCOW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|