C14H10N2O — CID 11528667
3-(1,3-dihydrofuro[3,4-c]pyridin-1-yl)benzonitrile (PubChem CID 11528667) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-(1,3-dihydrofuro[3,4-c]pyridin-1-yl)benzonitrile.
| Compound Name | 3-(1,3-dihydrofuro[3,4-c]pyridin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 11528667 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-(1,3-dihydrofuro[3,4-c]pyridin-1-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2OCc3cnccc32)c1 |
| InChI | InChI=1S/C14H10N2O/c15-7-10-2-1-3-11(6-10)14-13-4-5-16-8-12(13)9-17-14/h1-6,8,14H,9H2 |
| InChIKey | MKLXABVPOBJGJX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |