C13H17ClN4OS — CID 115290079
2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(1-methylpyrazol-4-yl)acetamide (PubChem CID 115290079) has the molecular formula C13H17ClN4OS and a molecular weight of 312.83 g/mol. Its IUPAC name is 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(1-methylpyrazol-4-yl)acetamide.
| Compound Name | 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(1-methylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 115290079 |
| Molecular Formula | C13H17ClN4OS |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-amino-N-[(5-chlorothiophen-2-yl)methyl]-N-ethyl-2-(1-methylpyrazol-4-yl)acetamide |
| SMILES | CCN(Cc1ccc(Cl)s1)C(=O)C(N)c1cnn(C)c1 |
| InChI | InChI=1S/C13H17ClN4OS/c1-3-18(8-10-4-5-11(14)20-10)13(19)12(15)9-6-16-17(2)7-9/h4-7,12H,3,8,15H2,1-2H3 |
| InChIKey | QJKURZXKHQNOHT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |