About 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid
4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid (PubChem CID 115293206) has the molecular formula C15H26N2O4
and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid |
| PubChem CID | 115293206 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid |
| SMILES | CC1CCC(NC(=O)NC2(C(=O)O)CCOCC2)C(C)C1 |
| InChI | InChI=1S/C15H26N2O4/c1-10-3-4-12(11(2)9-10)16-14(20)17-15(13(18)19)5-7-21-8-6-15/h10-12H,3-9H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | WAUMDYMZTBRKDG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid?
The IUPAC name of 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid (CID 115293206) is 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid.
What is the SMILES notation for 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid?
The canonical SMILES for 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid is CC1CCC(NC(=O)NC2(C(=O)O)CCOCC2)C(C)C1.
What is the InChIKey of 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid?
The InChIKey is WAUMDYMZTBRKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O4/c1-10-3-4-12(11(2)9-10)16-14(20)17-15(13(18)19)5-7-21-8-6-15/h10-12H,3-9H2,1-2H3,(H,18,19)(H2,16,17,20).
What are the key properties of 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid?
4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid has a molecular weight of 298.38 g/mol, XLogP of 1.74, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dimethylcyclohexyl)carbamoylamino]oxane-4-carboxylic acid is sourced from PubChem (CID 115293206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).