About 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid
2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid (PubChem CID 115295595) has the molecular formula C14H14BrN3O3
and a molecular weight of 352.19 g/mol. Its IUPAC name is 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid |
| PubChem CID | 115295595 |
| Molecular Formula | C14H14BrN3O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid |
| SMILES | Cc1n[nH]c(C)c1CC(=O)Nc1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H14BrN3O3/c1-7-10(8(2)18-17-7)6-13(19)16-9-3-4-12(15)11(5-9)14(20)21/h3-5H,6H2,1-2H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | PYEDNUXFPACEPV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid?
The IUPAC name of 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid (CID 115295595) is 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid.
What is the SMILES notation for 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid?
The canonical SMILES for 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid is Cc1n[nH]c(C)c1CC(=O)Nc1ccc(Br)c(C(=O)O)c1.
What is the InChIKey of 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid?
The InChIKey is PYEDNUXFPACEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3O3/c1-7-10(8(2)18-17-7)6-13(19)16-9-3-4-12(15)11(5-9)14(20)21/h3-5H,6H2,1-2H3,(H,16,19)(H,17,18)(H,20,21).
What are the key properties of 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid?
2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid has a molecular weight of 352.19 g/mol, XLogP of 2.67, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]benzoic acid is sourced from PubChem (CID 115295595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).