About 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid
2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid (PubChem CID 115296114) has the molecular formula C11H7BrN6O2
and a molecular weight of 335.12 g/mol. Its IUPAC name is 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid.
Molecular Properties
| Compound Name | 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid |
| PubChem CID | 115296114 |
| Molecular Formula | C11H7BrN6O2 |
| Molecular Weight | 335.12 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Nc2cncc3nnnn23)ccc1Br |
| InChI | InChI=1S/C11H7BrN6O2/c12-8-2-1-6(3-7(8)11(19)20)14-9-4-13-5-10-15-16-17-18(9)10/h1-5,14H,(H,19,20) |
| InChIKey | POTNIKCUYKBDDX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.12 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid?
The IUPAC name of 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid (CID 115296114) is 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid.
What is the SMILES notation for 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid?
The canonical SMILES for 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid is O=C(O)c1cc(Nc2cncc3nnnn23)ccc1Br.
What is the InChIKey of 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid?
The InChIKey is POTNIKCUYKBDDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrN6O2/c12-8-2-1-6(3-7(8)11(19)20)14-9-4-13-5-10-15-16-17-18(9)10/h1-5,14H,(H,19,20).
What are the key properties of 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid?
2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid has a molecular weight of 335.12 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(tetrazolo[1,5-a]pyrazin-5-ylamino)benzoic acid is sourced from PubChem (CID 115296114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).