C17H16N2O5 — CID 11529967
2-[[(E)-3-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 11529967) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-[[(E)-3-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[(E)-3-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11529967 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[[(E)-3-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1ncc(CO)c(/C=C/C(=O)Nc2ccccc2C(=O)O)c1O |
| InChI | InChI=1S/C17H16N2O5/c1-10-16(22)12(11(9-20)8-18-10)6-7-15(21)19-14-5-3-2-4-13(14)17(23)24/h2-8,20,22H,9H2,1H3,(H,19,21)(H,23,24)/b7-6+ |
| InChIKey | HOKGGLNJAWWSHC-VOTSOKGWSA-N |
| XLogP | 1.94 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|