C18H23NO5 — CID 11530069
3-[2-(1,3-dioxan-2-yl)ethyl]-7,8-dimethoxy-1H-3-benzazepin-2-one (PubChem CID 11530069) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is 3-[2-(1,3-dioxan-2-yl)ethyl]-7,8-dimethoxy-1H-3-benzazepin-2-one.
| Compound Name | 3-[2-(1,3-dioxan-2-yl)ethyl]-7,8-dimethoxy-1H-3-benzazepin-2-one |
|---|---|
| PubChem CID | 11530069 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-[2-(1,3-dioxan-2-yl)ethyl]-7,8-dimethoxy-1H-3-benzazepin-2-one |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCC1OCCCO1)C=C2 |
| InChI | InChI=1S/C18H23NO5/c1-21-15-10-13-4-6-19(7-5-18-23-8-3-9-24-18)17(20)12-14(13)11-16(15)22-2/h4,6,10-11,18H,3,5,7-9,12H2,1-2H3 |
| InChIKey | PCYJUYNAKNWNCL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |